C15H20O2S — CID 71950265
5,7-dimethyl-2,3,4,4a,9,9a-hexahydro-1H-thioxanthene 10,10-dioxide (PubChem CID 71950265) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is 5,7-dimethyl-2,3,4,4a,9,9a-hexahydro-1H-thioxanthene 10,10-dioxide.
| Compound Name | 5,7-dimethyl-2,3,4,4a,9,9a-hexahydro-1H-thioxanthene 10,10-dioxide |
|---|---|
| PubChem CID | 71950265 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 5,7-dimethyl-2,3,4,4a,9,9a-hexahydro-1H-thioxanthene 10,10-dioxide |
| SMILES | Cc1cc(C)c2c(c1)CC1CCCCC1S2(=O)=O |
| InChI | InChI=1S/C15H20O2S/c1-10-7-11(2)15-13(8-10)9-12-5-3-4-6-14(12)18(15,16)17/h7-8,12,14H,3-6,9H2,1-2H3 |
| InChIKey | AVMJHCNLLULUDU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |