C18H22O2S — CID 56696383
2,4,5,7,9a-pentamethyl-4a,9-dihydrothioxanthene 10,10-dioxide (PubChem CID 56696383) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is 2,4,5,7,9a-pentamethyl-4a,9-dihydrothioxanthene 10,10-dioxide.
| Compound Name | 2,4,5,7,9a-pentamethyl-4a,9-dihydrothioxanthene 10,10-dioxide |
|---|---|
| PubChem CID | 56696383 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2,4,5,7,9a-pentamethyl-4a,9-dihydrothioxanthene 10,10-dioxide |
| SMILES | CC1=CC2(C)Cc3cc(C)cc(C)c3S(=O)(=O)C2C(C)=C1 |
| InChI | InChI=1S/C18H22O2S/c1-11-6-13(3)16-15(8-11)10-18(5)9-12(2)7-14(4)17(18)21(16,19)20/h6-9,17H,10H2,1-5H3 |
| InChIKey | FQIXFDJXMNMOOR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |