C19H28 — CID 157288182
1,3,5,5-tetramethylcyclohexa-1,3-diene;1,3,5-trimethylbenzene (PubChem CID 157288182) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 1,3,5,5-tetramethylcyclohexa-1,3-diene;1,3,5-trimethylbenzene.
| Compound Name | 1,3,5,5-tetramethylcyclohexa-1,3-diene;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 157288182 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1,3,5,5-tetramethylcyclohexa-1,3-diene;1,3,5-trimethylbenzene |
| SMILES | CC1=CC(C)(C)CC(C)=C1.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C10H16.C9H12/c1-8-5-9(2)7-10(3,4)6-8;1-7-4-8(2)6-9(3)5-7/h5-6H,7H2,1-4H3;4-6H,1-3H3 |
| InChIKey | BAMIGOWVXNBYOB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |