C9H15NO2S — CID 141048188
1,3,5-trimethylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 141048188) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 1,3,5-trimethylcyclohexa-2,4-diene-1-sulfonamide.
| Compound Name | 1,3,5-trimethylcyclohexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 141048188 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1,3,5-trimethylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CC1=CC(C)(S(N)(=O)=O)CC(C)=C1 |
| InChI | InChI=1S/C9H15NO2S/c1-7-4-8(2)6-9(3,5-7)13(10,11)12/h4-5H,6H2,1-3H3,(H2,10,11,12) |
| InChIKey | WJBLUJNCGQAQIN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |