C8H13NO2S — CID 139833149
1,3-dimethylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 139833149) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 1,3-dimethylcyclohexa-2,4-diene-1-sulfonamide.
| Compound Name | 1,3-dimethylcyclohexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 139833149 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 1,3-dimethylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CC1=CC(C)(S(N)(=O)=O)CC=C1 |
| InChI | InChI=1S/C8H13NO2S/c1-7-4-3-5-8(2,6-7)12(9,10)11/h3-4,6H,5H2,1-2H3,(H2,9,10,11) |
| InChIKey | OXIYLHMWTUCZGS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |