C16H22O6S2Sr — CID 139842170
strontium bis(1,4-dimethylcyclohexa-2,4-diene-1-sulfonate) (PubChem CID 139842170) has the molecular formula C16H22O6S2Sr and a molecular weight of 462.10 g/mol. Its IUPAC name is strontium bis(1,4-dimethylcyclohexa-2,4-diene-1-sulfonate).
| Compound Name | strontium bis(1,4-dimethylcyclohexa-2,4-diene-1-sulfonate) |
|---|---|
| PubChem CID | 139842170 |
| Molecular Formula | C16H22O6S2Sr |
| Molecular Weight | 462.10 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | strontium bis(1,4-dimethylcyclohexa-2,4-diene-1-sulfonate) |
| SMILES | CC1=CCC(C)(S(=O)(=O)[O-])C=C1.CC1=CCC(C)(S(=O)(=O)[O-])C=C1.[Sr+2] |
| InChI | InChI=1S/2C8H12O3S.Sr/c2*1-7-3-5-8(2,6-4-7)12(9,10)11;/h2*3-5H,6H2,1-2H3,(H,9,10,11);/q;;+2/p-2 |
| InChIKey | UKUJGVWKEXNHED-UHFFFAOYSA-L |
| XLogP | 2.01 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.10 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|