C15H12N2O4 — CID 154480031
1-[1-(2,5-dioxopyrrol-1-yl)-4-methylcyclohexa-2,4-dien-1-yl]pyrrole-2,5-dione (PubChem CID 154480031) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 1-[1-(2,5-dioxopyrrol-1-yl)-4-methylcyclohexa-2,4-dien-1-yl]pyrrole-2,5-dione.
| Compound Name | 1-[1-(2,5-dioxopyrrol-1-yl)-4-methylcyclohexa-2,4-dien-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 154480031 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-[1-(2,5-dioxopyrrol-1-yl)-4-methylcyclohexa-2,4-dien-1-yl]pyrrole-2,5-dione |
| SMILES | CC1=CCC(N2C(=O)C=CC2=O)(N2C(=O)C=CC2=O)C=C1 |
| InChI | InChI=1S/C15H12N2O4/c1-10-6-8-15(9-7-10,16-11(18)2-3-12(16)19)17-13(20)4-5-14(17)21/h2-8H,9H2,1H3 |
| InChIKey | BUMQNTOTOBVPHC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|