C14H16O — CID 140996637
2-(1,4-dimethylcyclohexa-2,4-dien-1-yl)phenol (PubChem CID 140996637) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(1,4-dimethylcyclohexa-2,4-dien-1-yl)phenol.
| Compound Name | 2-(1,4-dimethylcyclohexa-2,4-dien-1-yl)phenol |
|---|---|
| PubChem CID | 140996637 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-(1,4-dimethylcyclohexa-2,4-dien-1-yl)phenol |
| SMILES | CC1=CCC(C)(c2ccccc2O)C=C1 |
| InChI | InChI=1S/C14H16O/c1-11-7-9-14(2,10-8-11)12-5-3-4-6-13(12)15/h3-9,15H,10H2,1-2H3 |
| InChIKey | WKXSPUDECRRQFK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |