About (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium
(1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium (PubChem CID 141041567) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium.
Molecular Properties
| Compound Name | (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium |
| PubChem CID | 141041567 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium |
| SMILES | CC1=CCC(C)([NH2+][O-])C=C1 |
| InChI | InChI=1S/C8H13NO/c1-7-3-5-8(2,9-10)6-4-7/h3-5H,6,9H2,1-2H3 |
| InChIKey | YXLRDSINQLBILS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium?
The IUPAC name of (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium (CID 141041567) is (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium.
What is the SMILES notation for (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium?
The canonical SMILES for (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium is CC1=CCC(C)([NH2+][O-])C=C1.
What is the InChIKey of (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium?
The InChIKey is YXLRDSINQLBILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-7-3-5-8(2,9-10)6-4-7/h3-5H,6,9H2,1-2H3.
What are the key properties of (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium?
(1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium has a molecular weight of 139.20 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dimethylcyclohexa-2,4-dien-1-yl)-oxidoazanium is sourced from PubChem (CID 141041567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).