C7H11NO — CID 141138802
(1-methylcyclohexa-2,4-dien-1-yl)-oxidoazanium (PubChem CID 141138802) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (1-methylcyclohexa-2,4-dien-1-yl)-oxidoazanium.
| Compound Name | (1-methylcyclohexa-2,4-dien-1-yl)-oxidoazanium |
|---|---|
| PubChem CID | 141138802 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (1-methylcyclohexa-2,4-dien-1-yl)-oxidoazanium |
| SMILES | CC1([NH2+][O-])C=CC=CC1 |
| InChI | InChI=1S/C7H11NO/c1-7(8-9)5-3-2-4-6-7/h2-5H,6,8H2,1H3 |
| InChIKey | XYGTVAZHYVVIFA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|