About (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid
(1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid (PubChem CID 175786929) has the molecular formula C7H11AlO4P2+2
and a molecular weight of 248.09 g/mol. Its IUPAC name is (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid.
Molecular Properties
| Compound Name | (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid |
| PubChem CID | 175786929 |
| Molecular Formula | C7H11AlO4P2+2 |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid |
| SMILES | CC1([Al+2])C=CC=CC1.O=PO.O=PO |
| InChI | InChI=1S/C7H9.Al.2HO2P/c1-7-5-3-2-4-6-7;;2*1-3-2/h2-5H,6H2,1H3;;2*(H,1,2)/q;+2;; |
| InChIKey | LPUVNWNBPFGEJG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid?
The IUPAC name of (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid (CID 175786929) is (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid.
What is the SMILES notation for (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid?
The canonical SMILES for (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid is CC1([Al+2])C=CC=CC1.O=PO.O=PO.
What is the InChIKey of (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid?
The InChIKey is LPUVNWNBPFGEJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9.Al.2HO2P/c1-7-5-3-2-4-6-7;;2*1-3-2/h2-5H,6H2,1H3;;2*(H,1,2)/q;+2;;.
What are the key properties of (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid?
(1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid has a molecular weight of 248.09 g/mol, XLogP of 2.22, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclohexa-2,4-dien-1-yl)aluminum(2+);phosphenous acid is sourced from PubChem (CID 175786929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).