About 1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone
1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone (PubChem CID 141023556) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone.
Analyze 1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone?
The IUPAC name of 1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone (CID 141023556) is 1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone.
What is the SMILES notation for 1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone?
The canonical SMILES for 1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone is CC(=O)C1(CO)C=CC=CC1.
What is the InChIKey of 1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone?
The InChIKey is KWRZWFQKWXBCFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-8(11)9(7-10)5-3-2-4-6-9/h2-5,10H,6-7H2,1H3.
What are the key properties of 1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone?
1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone has a molecular weight of 152.19 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(hydroxymethyl)cyclohexa-2,4-dien-1-yl]ethanone is sourced from PubChem (CID 141023556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).