C10H17NO2 — CID 53446414
acetic acid;1-ethylcyclohexa-2,4-dien-1-amine (PubChem CID 53446414) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is acetic acid;1-ethylcyclohexa-2,4-dien-1-amine.
| Compound Name | acetic acid;1-ethylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 53446414 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | acetic acid;1-ethylcyclohexa-2,4-dien-1-amine |
| SMILES | CC(=O)O.CCC1(N)C=CC=CC1 |
| InChI | InChI=1S/C8H13N.C2H4O2/c1-2-8(9)6-4-3-5-7-8;1-2(3)4/h3-6H,2,7,9H2,1H3;1H3,(H,3,4) |
| InChIKey | KDJPCFNAORAAAX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |