C10H14O — CID 141230573
2-(1-ethylcyclohexa-2,4-dien-1-yl)ethenol (PubChem CID 141230573) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-(1-ethylcyclohexa-2,4-dien-1-yl)ethenol.
| Compound Name | 2-(1-ethylcyclohexa-2,4-dien-1-yl)ethenol |
|---|---|
| PubChem CID | 141230573 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-(1-ethylcyclohexa-2,4-dien-1-yl)ethenol |
| SMILES | CCC1(C=CO)C=CC=CC1 |
| InChI | InChI=1S/C10H14O/c1-2-10(8-9-11)6-4-3-5-7-10/h3-6,8-9,11H,2,7H2,1H3 |
| InChIKey | IZYAPAWGRYKXJD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|