C18H28O — CID 139960072
5-butyl-5-(2-cyclohexyloxyethenyl)cyclohexa-1,3-diene (PubChem CID 139960072) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is 5-butyl-5-(2-cyclohexyloxyethenyl)cyclohexa-1,3-diene.
| Compound Name | 5-butyl-5-(2-cyclohexyloxyethenyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 139960072 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 5-butyl-5-(2-cyclohexyloxyethenyl)cyclohexa-1,3-diene |
| SMILES | CCCCC1(C=COC2CCCCC2)C=CC=CC1 |
| InChI | InChI=1S/C18H28O/c1-2-3-12-18(13-8-5-9-14-18)15-16-19-17-10-6-4-7-11-17/h5,8-9,13,15-17H,2-4,6-7,10-12,14H2,1H3 |
| InChIKey | NQIOZMFOTWCSFY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|