C20H30O4 — CID 140676685
diethyl 2-[(1-hexylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate (PubChem CID 140676685) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is diethyl 2-[(1-hexylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate.
| Compound Name | diethyl 2-[(1-hexylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate |
|---|---|
| PubChem CID | 140676685 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | diethyl 2-[(1-hexylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate |
| SMILES | CCCCCCC1(C=C(C(=O)OCC)C(=O)OCC)C=CC=CC1 |
| InChI | InChI=1S/C20H30O4/c1-4-7-8-10-13-20(14-11-9-12-15-20)16-17(18(21)23-5-2)19(22)24-6-3/h9,11-12,14,16H,4-8,10,13,15H2,1-3H3 |
| InChIKey | FCVXQKCUZDVXRT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|