C23H36O4 — CID 137373716
bis(2-methylpropyl) 2-[(1-pentylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate (PubChem CID 137373716) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is bis(2-methylpropyl) 2-[(1-pentylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate.
| Compound Name | bis(2-methylpropyl) 2-[(1-pentylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate |
|---|---|
| PubChem CID | 137373716 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | bis(2-methylpropyl) 2-[(1-pentylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate |
| SMILES | CCCCCC1(C=C(C(=O)OCC(C)C)C(=O)OCC(C)C)C=CC=CC1 |
| InChI | InChI=1S/C23H36O4/c1-6-7-9-12-23(13-10-8-11-14-23)15-20(21(24)26-16-18(2)3)22(25)27-17-19(4)5/h8,10-11,13,15,18-19H,6-7,9,12,14,16-17H2,1-5H3 |
| InChIKey | SKVGMRYIWHCDEI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|