C19H28O4 — CID 140676679
diethyl 2-[(1-pentylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate (PubChem CID 140676679) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is diethyl 2-[(1-pentylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate.
| Compound Name | diethyl 2-[(1-pentylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate |
|---|---|
| PubChem CID | 140676679 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | diethyl 2-[(1-pentylcyclohexa-2,4-dien-1-yl)methylidene]propanedioate |
| SMILES | CCCCCC1(C=C(C(=O)OCC)C(=O)OCC)C=CC=CC1 |
| InChI | InChI=1S/C19H28O4/c1-4-7-9-12-19(13-10-8-11-14-19)15-16(17(20)22-5-2)18(21)23-6-3/h8,10-11,13,15H,4-7,9,12,14H2,1-3H3 |
| InChIKey | MNRDCVXATWFBSJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|