C14H23NO3 — CID 68601963
5-nitro-5-octoxycyclohexa-1,3-diene (PubChem CID 68601963) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 5-nitro-5-octoxycyclohexa-1,3-diene.
| Compound Name | 5-nitro-5-octoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 68601963 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 5-nitro-5-octoxycyclohexa-1,3-diene |
| SMILES | CCCCCCCCOC1([N+](=O)[O-])C=CC=CC1 |
| InChI | InChI=1S/C14H23NO3/c1-2-3-4-5-6-10-13-18-14(15(16)17)11-8-7-9-12-14/h7-9,11H,2-6,10,12-13H2,1H3 |
| InChIKey | WTOYWVTZWLOZJX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|