C17H22O — CID 154489063
(1-pentoxycyclohexa-2,4-dien-1-yl)benzene (PubChem CID 154489063) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (1-pentoxycyclohexa-2,4-dien-1-yl)benzene.
| Compound Name | (1-pentoxycyclohexa-2,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 154489063 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (1-pentoxycyclohexa-2,4-dien-1-yl)benzene |
| SMILES | CCCCCOC1(c2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C17H22O/c1-2-3-10-15-18-17(13-8-5-9-14-17)16-11-6-4-7-12-16/h4-9,11-13H,2-3,10,14-15H2,1H3 |
| InChIKey | DVAQIYBAALSQBC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|