C31H41FO2 — CID 67800171
(5S)-1-fluoro-2-(4-heptan-2-yloxyphenyl)-5-hexoxy-5-phenylcyclohexa-1,3-diene (PubChem CID 67800171) has the molecular formula C31H41FO2 and a molecular weight of 464.67 g/mol. Its IUPAC name is (5S)-1-fluoro-2-(4-heptan-2-yloxyphenyl)-5-hexoxy-5-phenylcyclohexa-1,3-diene.
| Compound Name | (5S)-1-fluoro-2-(4-heptan-2-yloxyphenyl)-5-hexoxy-5-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 67800171 |
| Molecular Formula | C31H41FO2 |
| Molecular Weight | 464.67 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (5S)-1-fluoro-2-(4-heptan-2-yloxyphenyl)-5-hexoxy-5-phenylcyclohexa-1,3-diene |
| SMILES | CCCCCCO[C@]1(c2ccccc2)C=CC(c2ccc(OC(C)CCCCC)cc2)=C(F)C1 |
| InChI | InChI=1S/C31H41FO2/c1-4-6-8-13-23-33-31(27-15-11-9-12-16-27)22-21-29(30(32)24-31)26-17-19-28(20-18-26)34-25(3)14-10-7-5-2/h9,11-12,15-22,25H,4-8,10,13-14,23-24H2,1-3H3/t25?,31-/m1/s1 |
| InChIKey | OHMZBLOHPCLWPT-LDCRUHPQSA-N |
| XLogP | 9.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.67 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|