C17H20F2O — CID 67939710
1,5-difluoro-5-pentoxy-2-phenylcyclohexa-1,3-diene (PubChem CID 67939710) has the molecular formula C17H20F2O and a molecular weight of 278.34 g/mol. Its IUPAC name is 1,5-difluoro-5-pentoxy-2-phenylcyclohexa-1,3-diene.
| Compound Name | 1,5-difluoro-5-pentoxy-2-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 67939710 |
| Molecular Formula | C17H20F2O |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1,5-difluoro-5-pentoxy-2-phenylcyclohexa-1,3-diene |
| SMILES | CCCCCOC1(F)C=CC(c2ccccc2)=C(F)C1 |
| InChI | InChI=1S/C17H20F2O/c1-2-3-7-12-20-17(19)11-10-15(16(18)13-17)14-8-5-4-6-9-14/h4-6,8-11H,2-3,7,12-13H2,1H3 |
| InChIKey | JCUVWFDPSORFLG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|