C33H36F2O — CID 67861957
5-butoxy-1,6-difluoro-5-pentyl-2-[4-(4-phenylphenyl)phenyl]cyclohexa-1,3-diene (PubChem CID 67861957) has the molecular formula C33H36F2O and a molecular weight of 486.65 g/mol. Its IUPAC name is 5-butoxy-1,6-difluoro-5-pentyl-2-[4-(4-phenylphenyl)phenyl]cyclohexa-1,3-diene.
| Compound Name | 5-butoxy-1,6-difluoro-5-pentyl-2-[4-(4-phenylphenyl)phenyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 67861957 |
| Molecular Formula | C33H36F2O |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 5-butoxy-1,6-difluoro-5-pentyl-2-[4-(4-phenylphenyl)phenyl]cyclohexa-1,3-diene |
| SMILES | CCCCCC1(OCCCC)C=CC(c2ccc(-c3ccc(-c4ccccc4)cc3)cc2)=C(F)C1F |
| InChI | InChI=1S/C33H36F2O/c1-3-5-10-22-33(36-24-6-4-2)23-21-30(31(34)32(33)35)29-19-17-28(18-20-29)27-15-13-26(14-16-27)25-11-8-7-9-12-25/h7-9,11-21,23,32H,3-6,10,22,24H2,1-2H3 |
| InChIKey | QZCMBAQHUMZFRB-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|