C19H22F4O2 — CID 175215323
5-butoxy-2-(2,3-difluorophenyl)-1,6-difluoro-5-propoxycyclohexa-1,3-diene (PubChem CID 175215323) has the molecular formula C19H22F4O2 and a molecular weight of 358.38 g/mol. Its IUPAC name is 5-butoxy-2-(2,3-difluorophenyl)-1,6-difluoro-5-propoxycyclohexa-1,3-diene.
| Compound Name | 5-butoxy-2-(2,3-difluorophenyl)-1,6-difluoro-5-propoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175215323 |
| Molecular Formula | C19H22F4O2 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 5-butoxy-2-(2,3-difluorophenyl)-1,6-difluoro-5-propoxycyclohexa-1,3-diene |
| SMILES | CCCCOC1(OCCC)C=CC(c2cccc(F)c2F)=C(F)C1F |
| InChI | InChI=1S/C19H22F4O2/c1-3-5-12-25-19(24-11-4-2)10-9-14(17(22)18(19)23)13-7-6-8-15(20)16(13)21/h6-10,18H,3-5,11-12H2,1-2H3 |
| InChIKey | GDSPVQWUTCYJJG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|