C19H22BrF3 — CID 70189476
5-bromo-1,6-difluoro-2-(2-fluorophenyl)-5-heptylcyclohexa-1,3-diene (PubChem CID 70189476) has the molecular formula C19H22BrF3 and a molecular weight of 387.28 g/mol. Its IUPAC name is 5-bromo-1,6-difluoro-2-(2-fluorophenyl)-5-heptylcyclohexa-1,3-diene.
| Compound Name | 5-bromo-1,6-difluoro-2-(2-fluorophenyl)-5-heptylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 70189476 |
| Molecular Formula | C19H22BrF3 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 5-bromo-1,6-difluoro-2-(2-fluorophenyl)-5-heptylcyclohexa-1,3-diene |
| SMILES | CCCCCCCC1(Br)C=CC(c2ccccc2F)=C(F)C1F |
| InChI | InChI=1S/C19H22BrF3/c1-2-3-4-5-8-12-19(20)13-11-15(17(22)18(19)23)14-9-6-7-10-16(14)21/h6-7,9-11,13,18H,2-5,8,12H2,1H3 |
| InChIKey | KQBOBFWPTYDWNU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|