C30H44F2O3 — CID 67784338
2-(5,6-difluoro-1-heptoxy-4-phenylcyclohexa-2,4-dien-1-yl)-5-heptyl-1,3-dioxane (PubChem CID 67784338) has the molecular formula C30H44F2O3 and a molecular weight of 490.68 g/mol. Its IUPAC name is 2-(5,6-difluoro-1-heptoxy-4-phenylcyclohexa-2,4-dien-1-yl)-5-heptyl-1,3-dioxane.
| Compound Name | 2-(5,6-difluoro-1-heptoxy-4-phenylcyclohexa-2,4-dien-1-yl)-5-heptyl-1,3-dioxane |
|---|---|
| PubChem CID | 67784338 |
| Molecular Formula | C30H44F2O3 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 2-(5,6-difluoro-1-heptoxy-4-phenylcyclohexa-2,4-dien-1-yl)-5-heptyl-1,3-dioxane |
| SMILES | CCCCCCCOC1(C2OCC(CCCCCCC)CO2)C=CC(c2ccccc2)=C(F)C1F |
| InChI | InChI=1S/C30H44F2O3/c1-3-5-7-9-12-16-24-22-33-29(34-23-24)30(35-21-15-10-8-6-4-2)20-19-26(27(31)28(30)32)25-17-13-11-14-18-25/h11,13-14,17-20,24,28-29H,3-10,12,15-16,21-23H2,1-2H3 |
| InChIKey | BWRPOIBIJNANJS-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|