C23H30BrFO — CID 175175584
5-bromo-6-fluoro-5-(4-pentylcyclohexyl)-2-phenylcyclohexa-1,3-dien-1-ol (PubChem CID 175175584) has the molecular formula C23H30BrFO and a molecular weight of 421.39 g/mol. Its IUPAC name is 5-bromo-6-fluoro-5-(4-pentylcyclohexyl)-2-phenylcyclohexa-1,3-dien-1-ol.
| Compound Name | 5-bromo-6-fluoro-5-(4-pentylcyclohexyl)-2-phenylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 175175584 |
| Molecular Formula | C23H30BrFO |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 5-bromo-6-fluoro-5-(4-pentylcyclohexyl)-2-phenylcyclohexa-1,3-dien-1-ol |
| SMILES | CCCCCC1CCC(C2(Br)C=CC(c3ccccc3)=C(O)C2F)CC1 |
| InChI | InChI=1S/C23H30BrFO/c1-2-3-5-8-17-11-13-19(14-12-17)23(24)16-15-20(21(26)22(23)25)18-9-6-4-7-10-18/h4,6-7,9-10,15-17,19,22,26H,2-3,5,8,11-14H2,1H3 |
| InChIKey | UFMVCEUKRHYNNL-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|