C24H30FO2- — CID 53429816
4-fluoro-4-(4-pentylcyclohexyl)-2-phenylcyclohexa-1,5-diene-1-carboxylate (PubChem CID 53429816) has the molecular formula C24H30FO2- and a molecular weight of 369.50 g/mol. Its IUPAC name is 4-fluoro-4-(4-pentylcyclohexyl)-2-phenylcyclohexa-1,5-diene-1-carboxylate.
| Compound Name | 4-fluoro-4-(4-pentylcyclohexyl)-2-phenylcyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 53429816 |
| Molecular Formula | C24H30FO2- |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 4-fluoro-4-(4-pentylcyclohexyl)-2-phenylcyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCCCCC1CCC(C2(F)C=CC(C(=O)[O-])=C(c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C24H31FO2/c1-2-3-5-8-18-11-13-20(14-12-18)24(25)16-15-21(23(26)27)22(17-24)19-9-6-4-7-10-19/h4,6-7,9-10,15-16,18,20H,2-3,5,8,11-14,17H2,1H3,(H,26,27)/p-1 |
| InChIKey | UOTCKXRRXHLPAK-UHFFFAOYSA-M |
| XLogP | 5.24 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|