C25H30FNO2 — CID 67659368
4-(2-cyanophenyl)-3-fluoro-4-(4-pentylcyclohexyl)cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 67659368) has the molecular formula C25H30FNO2 and a molecular weight of 395.52 g/mol. Its IUPAC name is 4-(2-cyanophenyl)-3-fluoro-4-(4-pentylcyclohexyl)cyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 4-(2-cyanophenyl)-3-fluoro-4-(4-pentylcyclohexyl)cyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 67659368 |
| Molecular Formula | C25H30FNO2 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 4-(2-cyanophenyl)-3-fluoro-4-(4-pentylcyclohexyl)cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCCCCC1CCC(C2(c3ccccc3C#N)C=CC(C(=O)O)C=C2F)CC1 |
| InChI | InChI=1S/C25H30FNO2/c1-2-3-4-7-18-10-12-21(13-11-18)25(22-9-6-5-8-20(22)17-27)15-14-19(24(28)29)16-23(25)26/h5-6,8-9,14-16,18-19,21H,2-4,7,10-13H2,1H3,(H,28,29) |
| InChIKey | SDZPNVWOPBVUIF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|