C24H26FNO2 — CID 67791484
4-(4-but-3-enylcyclohexyl)-4-cyano-3-(2-fluorophenyl)cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 67791484) has the molecular formula C24H26FNO2 and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-(4-but-3-enylcyclohexyl)-4-cyano-3-(2-fluorophenyl)cyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 4-(4-but-3-enylcyclohexyl)-4-cyano-3-(2-fluorophenyl)cyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 67791484 |
| Molecular Formula | C24H26FNO2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-(4-but-3-enylcyclohexyl)-4-cyano-3-(2-fluorophenyl)cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | C=CCCC1CCC(C2(C#N)C=CC(C(=O)O)C=C2c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H26FNO2/c1-2-3-6-17-9-11-19(12-10-17)24(16-26)14-13-18(23(27)28)15-21(24)20-7-4-5-8-22(20)25/h2,4-5,7-8,13-15,17-19H,1,3,6,9-12H2,(H,27,28) |
| InChIKey | FOFMEFBGUKCXDL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|