C29H34N2 — CID 143048760
3-[(5S)-2-hex-5-enyl-2-azatricyclo[5.2.0.01,3]nonan-5-yl]-2,2-diphenylpropanenitrile (PubChem CID 143048760) has the molecular formula C29H34N2 and a molecular weight of 410.61 g/mol. Its IUPAC name is 3-[(5S)-2-hex-5-enyl-2-azatricyclo[5.2.0.01,3]nonan-5-yl]-2,2-diphenylpropanenitrile.
| Compound Name | 3-[(5S)-2-hex-5-enyl-2-azatricyclo[5.2.0.01,3]nonan-5-yl]-2,2-diphenylpropanenitrile |
|---|---|
| PubChem CID | 143048760 |
| Molecular Formula | C29H34N2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 3-[(5S)-2-hex-5-enyl-2-azatricyclo[5.2.0.01,3]nonan-5-yl]-2,2-diphenylpropanenitrile |
| SMILES | C=CCCCCN1C2C[C@H](CC(C#N)(c3ccccc3)c3ccccc3)CC3CCC321 |
| InChI | InChI=1S/C29H34N2/c1-2-3-4-11-18-31-27-20-23(19-26-16-17-29(26,27)31)21-28(22-30,24-12-7-5-8-13-24)25-14-9-6-10-15-25/h2,5-10,12-15,23,26-27H,1,3-4,11,16-21H2/t23-,26?,27?,29?,31?/m1/s1 |
| InChIKey | MSOCIYMAAIQAGY-LTEFXYMJSA-N |
| XLogP | 6.49 |
| TPSA | 26.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|