C33H37N2O+ — CID 58894170
3-[(4S,6S)-5-methyl-5-(3-phenoxypropyl)-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile (PubChem CID 58894170) has the molecular formula C33H37N2O+ and a molecular weight of 477.67 g/mol. Its IUPAC name is 3-[(4S,6S)-5-methyl-5-(3-phenoxypropyl)-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile.
| Compound Name | 3-[(4S,6S)-5-methyl-5-(3-phenoxypropyl)-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile |
|---|---|
| PubChem CID | 58894170 |
| Molecular Formula | C33H37N2O+ |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 3-[(4S,6S)-5-methyl-5-(3-phenoxypropyl)-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile |
| SMILES | C[N+]1(CCCOc2ccccc2)[C@H]2CCC23CC(CC(C#N)(c2ccccc2)c2ccccc2)C[C@@H]31 |
| InChI | InChI=1S/C33H37N2O/c1-35(20-11-21-36-29-16-9-4-10-17-29)30-18-19-32(30)23-26(22-31(32)35)24-33(25-34,27-12-5-2-6-13-27)28-14-7-3-8-15-28/h2-10,12-17,26,30-31H,11,18-24H2,1H3/q+1/t26?,30-,31-,32?,35?/m0/s1 |
| InChIKey | FJGKFXANCGUSHU-YLBWFAQHSA-N |
| XLogP | 6.74 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|