C28H33N2+ — CID 58894169
3-[(4S,6S,8S)-5-(cyclopropylmethyl)-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile (PubChem CID 58894169) has the molecular formula C28H33N2+ and a molecular weight of 397.59 g/mol. Its IUPAC name is 3-[(4S,6S,8S)-5-(cyclopropylmethyl)-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile.
| Compound Name | 3-[(4S,6S,8S)-5-(cyclopropylmethyl)-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile |
|---|---|
| PubChem CID | 58894169 |
| Molecular Formula | C28H33N2+ |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 3-[(4S,6S,8S)-5-(cyclopropylmethyl)-5-methyl-5-azoniatricyclo[4.3.0.01,4]nonan-8-yl]-2,2-diphenylpropanenitrile |
| SMILES | C[N+]1(CC2CC2)[C@H]2CCC23C[C@@H](CC(C#N)(c2ccccc2)c2ccccc2)C[C@@H]31 |
| InChI | InChI=1S/C28H33N2/c1-30(19-21-12-13-21)25-14-15-27(25)17-22(16-26(27)30)18-28(20-29,23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-11,21-22,25-26H,12-19H2,1H3/q+1/t22-,25-,26-,27?,30?/m0/s1 |
| InChIKey | ABQBWOXKYLMVJL-QDPYTBCNSA-N |
| XLogP | 5.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|