C25H31N2+ — CID 71028670
3-[(6S,7aS)-1,1-dimethyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ium-6-yl]-2,2-diphenylpropanenitrile (PubChem CID 71028670) has the molecular formula C25H31N2+ and a molecular weight of 359.54 g/mol. Its IUPAC name is 3-[(6S,7aS)-1,1-dimethyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ium-6-yl]-2,2-diphenylpropanenitrile.
| Compound Name | 3-[(6S,7aS)-1,1-dimethyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ium-6-yl]-2,2-diphenylpropanenitrile |
|---|---|
| PubChem CID | 71028670 |
| Molecular Formula | C25H31N2+ |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 3-[(6S,7aS)-1,1-dimethyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ium-6-yl]-2,2-diphenylpropanenitrile |
| SMILES | C[N+]1(C)CCCC2C[C@@H](CC(C#N)(c3ccccc3)c3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C25H31N2/c1-27(2)15-9-10-21-16-20(17-24(21)27)18-25(19-26,22-11-5-3-6-12-22)23-13-7-4-8-14-23/h3-8,11-14,20-21,24H,9-10,15-18H2,1-2H3/q+1/t20-,21?,24+/m1/s1 |
| InChIKey | WICUKUCQUMKHMH-QQVDTZSYSA-N |
| XLogP | 5.15 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|