C20H25N2S2+ — CID 11420323
3-[(1S,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-dithiophen-2-ylpropanenitrile (PubChem CID 11420323) has the molecular formula C20H25N2S2+ and a molecular weight of 357.57 g/mol. Its IUPAC name is 3-[(1S,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-dithiophen-2-ylpropanenitrile.
| Compound Name | 3-[(1S,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-dithiophen-2-ylpropanenitrile |
|---|---|
| PubChem CID | 11420323 |
| Molecular Formula | C20H25N2S2+ |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-[(1S,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-2,2-dithiophen-2-ylpropanenitrile |
| SMILES | C[N+]1(C)[C@H]2CC[C@H]1CC(CC(C#N)(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C20H25N2S2/c1-22(2)16-7-8-17(22)12-15(11-16)13-20(14-21,18-5-3-9-23-18)19-6-4-10-24-19/h3-6,9-10,15-17H,7-8,11-13H2,1-2H3/q+1/t16-,17-/m0/s1 |
| InChIKey | VNWXSLVQCQTNPQ-IRXDYDNUSA-N |
| XLogP | 5.03 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|