C24H29N2+ — CID 11582653
3-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl)-2,2-diphenylpropanenitrile (PubChem CID 11582653) has the molecular formula C24H29N2+ and a molecular weight of 345.51 g/mol. Its IUPAC name is 3-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl)-2,2-diphenylpropanenitrile.
| Compound Name | 3-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl)-2,2-diphenylpropanenitrile |
|---|---|
| PubChem CID | 11582653 |
| Molecular Formula | C24H29N2+ |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 3-(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl)-2,2-diphenylpropanenitrile |
| SMILES | C[N+]1(C)C2CCC1CC(CC(C#N)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C24H29N2/c1-26(2)22-13-14-23(26)16-19(15-22)17-24(18-25,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,19,22-23H,13-17H2,1-2H3/q+1 |
| InChIKey | BKLAJZNVMHLXAP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|