C30H33BrN2 — CID 11306622
3-(8-benzyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl)-2,2-diphenylpropanenitrile bromide (PubChem CID 11306622) has the molecular formula C30H33BrN2 and a molecular weight of 501.51 g/mol. Its IUPAC name is 3-(8-benzyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl)-2,2-diphenylpropanenitrile bromide.
| Compound Name | 3-(8-benzyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl)-2,2-diphenylpropanenitrile bromide |
|---|---|
| PubChem CID | 11306622 |
| Molecular Formula | C30H33BrN2 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 3-(8-benzyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl)-2,2-diphenylpropanenitrile bromide |
| SMILES | C[N+]1(Cc2ccccc2)C2CCC1CC(CC(C#N)(c1ccccc1)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C30H33N2.BrH/c1-32(22-24-11-5-2-6-12-24)28-17-18-29(32)20-25(19-28)21-30(23-31,26-13-7-3-8-14-26)27-15-9-4-10-16-27;/h2-16,25,28-29H,17-22H2,1H3;1H/q+1;/p-1 |
| InChIKey | GEVMIHRCJZWWAG-UHFFFAOYSA-M |
| XLogP | 3.48 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|