C14H22N+ — CID 89308180
1-benzyl-1,2,5-trimethylpyrrolidin-1-ium (PubChem CID 89308180) has the molecular formula C14H22N+ and a molecular weight of 204.34 g/mol. Its IUPAC name is 1-benzyl-1,2,5-trimethylpyrrolidin-1-ium.
| Compound Name | 1-benzyl-1,2,5-trimethylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 89308180 |
| Molecular Formula | C14H22N+ |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 1-benzyl-1,2,5-trimethylpyrrolidin-1-ium |
| SMILES | CC1CCC(C)[N+]1(C)Cc1ccccc1 |
| InChI | InChI=1S/C14H22N/c1-12-9-10-13(2)15(12,3)11-14-7-5-4-6-8-14/h4-8,12-13H,9-11H2,1-3H3/q+1 |
| InChIKey | BXVSBSCDZSKPCQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|