C14H21N2+ — CID 163790789
(3aS,6aS)-5-benzyl-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ium (PubChem CID 163790789) has the molecular formula C14H21N2+ and a molecular weight of 217.34 g/mol. Its IUPAC name is (3aS,6aS)-5-benzyl-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ium.
| Compound Name | (3aS,6aS)-5-benzyl-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 163790789 |
| Molecular Formula | C14H21N2+ |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | (3aS,6aS)-5-benzyl-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-ium |
| SMILES | C[N+]1(Cc2ccccc2)C[C@@H]2CCN[C@@H]2C1 |
| InChI | InChI=1S/C14H21N2/c1-16(9-12-5-3-2-4-6-12)10-13-7-8-15-14(13)11-16/h2-6,13-15H,7-11H2,1H3/q+1/t13-,14+,16?/m0/s1 |
| InChIKey | HHAROJLPHJWWLC-NNKZFNQJSA-N |
| XLogP | 1.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|