C13H21N2+ — CID 123333567
1-benzyl-1-methylpiperidin-1-ium-3-amine (PubChem CID 123333567) has the molecular formula C13H21N2+ and a molecular weight of 205.33 g/mol. Its IUPAC name is 1-benzyl-1-methylpiperidin-1-ium-3-amine.
| Compound Name | 1-benzyl-1-methylpiperidin-1-ium-3-amine |
|---|---|
| PubChem CID | 123333567 |
| Molecular Formula | C13H21N2+ |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | 1-benzyl-1-methylpiperidin-1-ium-3-amine |
| SMILES | C[N+]1(Cc2ccccc2)CCCC(N)C1 |
| InChI | InChI=1S/C13H21N2/c1-15(9-5-8-13(14)11-15)10-12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11,14H2,1H3/q+1 |
| InChIKey | XVMKMNSRHFYHLM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|