C29H46N2O2 — CID 139666094
1-benzyl-1-methylpiperidin-1-ium;1-methyl-1-azoniatricyclo[9.2.2.13,7]hexadeca-3,5,7(16)-triene;dihydroxide (PubChem CID 139666094) has the molecular formula C29H46N2O2 and a molecular weight of 454.70 g/mol. Its IUPAC name is 1-benzyl-1-methylpiperidin-1-ium;1-methyl-1-azoniatricyclo[9.2.2.13,7]hexadeca-3,5,7(16)-triene;dihydroxide.
| Compound Name | 1-benzyl-1-methylpiperidin-1-ium;1-methyl-1-azoniatricyclo[9.2.2.13,7]hexadeca-3,5,7(16)-triene;dihydroxide |
|---|---|
| PubChem CID | 139666094 |
| Molecular Formula | C29H46N2O2 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.36 |
| IUPAC Name | 1-benzyl-1-methylpiperidin-1-ium;1-methyl-1-azoniatricyclo[9.2.2.13,7]hexadeca-3,5,7(16)-triene;dihydroxide |
| SMILES | C[N+]1(Cc2ccccc2)CCCCC1.C[N+]12CCC(CCCc3cccc(c3)C1)CC2.[OH-].[OH-] |
| InChI | InChI=1S/C16H24N.C13H20N.2H2O/c1-17-10-8-14(9-11-17)4-2-5-15-6-3-7-16(12-15)13-17;1-14(10-6-3-7-11-14)12-13-8-4-2-5-9-13;;/h3,6-7,12,14H,2,4-5,8-11,13H2,1H3;2,4-5,8-9H,3,6-7,10-12H2,1H3;2*1H2/q2*+1;;/p-2 |
| InChIKey | MWMMEAMBLVCORU-UHFFFAOYSA-L |
| XLogP | 5.84 |
| TPSA | 60.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|