C25H36N2+2 — CID 166930456
1-methyl-2-[4-[(1-methylpyrrolidin-1-ium-1-yl)methyl]phenyl]-1-(2-phenylethyl)pyrrolidin-1-ium (PubChem CID 166930456) has the molecular formula C25H36N2+2 and a molecular weight of 364.58 g/mol. Its IUPAC name is 1-methyl-2-[4-[(1-methylpyrrolidin-1-ium-1-yl)methyl]phenyl]-1-(2-phenylethyl)pyrrolidin-1-ium.
| Compound Name | 1-methyl-2-[4-[(1-methylpyrrolidin-1-ium-1-yl)methyl]phenyl]-1-(2-phenylethyl)pyrrolidin-1-ium |
|---|---|
| PubChem CID | 166930456 |
| Molecular Formula | C25H36N2+2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.29 |
| IUPAC Name | 1-methyl-2-[4-[(1-methylpyrrolidin-1-ium-1-yl)methyl]phenyl]-1-(2-phenylethyl)pyrrolidin-1-ium |
| SMILES | C[N+]1(Cc2ccc(C3CCC[N+]3(C)CCc3ccccc3)cc2)CCCC1 |
| InChI | InChI=1S/C25H36N2/c1-26(17-6-7-18-26)21-23-12-14-24(15-13-23)25-11-8-19-27(25,2)20-16-22-9-4-3-5-10-22/h3-5,9-10,12-15,25H,6-8,11,16-21H2,1-2H3/q+2 |
| InChIKey | ROBPECZJMRIXDA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|