C21H25N2+ — CID 124909726
3-[(1R,2R)-1-benzyl-1-methylpiperidin-1-ium-2-yl]-1H-indole (PubChem CID 124909726) has the molecular formula C21H25N2+ and a molecular weight of 305.45 g/mol. Its IUPAC name is 3-[(1R,2R)-1-benzyl-1-methylpiperidin-1-ium-2-yl]-1H-indole.
| Compound Name | 3-[(1R,2R)-1-benzyl-1-methylpiperidin-1-ium-2-yl]-1H-indole |
|---|---|
| PubChem CID | 124909726 |
| Molecular Formula | C21H25N2+ |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 3-[(1R,2R)-1-benzyl-1-methylpiperidin-1-ium-2-yl]-1H-indole |
| SMILES | C[N@+]1(Cc2ccccc2)CCCC[C@@H]1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H25N2/c1-23(16-17-9-3-2-4-10-17)14-8-7-13-21(23)19-15-22-20-12-6-5-11-18(19)20/h2-6,9-12,15,21-22H,7-8,13-14,16H2,1H3/q+1/t21-,23-/m1/s1 |
| InChIKey | CASFNYGDAWOYFW-FYYLOGMGSA-N |
| XLogP | 5.04 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|