C22H29N4+ — CID 57267680
1-(1-benzylpiperidin-1-ium-1-yl)-2-[2-(1H-indol-3-yl)ethyl]hydrazine (PubChem CID 57267680) has the molecular formula C22H29N4+ and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-1-ium-1-yl)-2-[2-(1H-indol-3-yl)ethyl]hydrazine.
| Compound Name | 1-(1-benzylpiperidin-1-ium-1-yl)-2-[2-(1H-indol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 57267680 |
| Molecular Formula | C22H29N4+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 1-(1-benzylpiperidin-1-ium-1-yl)-2-[2-(1H-indol-3-yl)ethyl]hydrazine |
| SMILES | c1ccc(C[N+]2(NNCCc3c[nH]c4ccccc34)CCCCC2)cc1 |
| InChI | InChI=1S/C22H29N4/c1-3-9-19(10-4-1)18-26(15-7-2-8-16-26)25-24-14-13-20-17-23-22-12-6-5-11-21(20)22/h1,3-6,9-12,17,23-25H,2,7-8,13-16,18H2/q+1 |
| InChIKey | BIHVASIZSIYFPC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|