C34H35N3 — CID 155805566
(6R,15S)-6,15-bis(1H-indol-3-yl)-6,7,8,9,10,11,12,13,14,15-decahydro-5H-cyclododeca[b]indole (PubChem CID 155805566) has the molecular formula C34H35N3 and a molecular weight of 485.68 g/mol. Its IUPAC name is (6R,15S)-6,15-bis(1H-indol-3-yl)-6,7,8,9,10,11,12,13,14,15-decahydro-5H-cyclododeca[b]indole.
| Compound Name | (6R,15S)-6,15-bis(1H-indol-3-yl)-6,7,8,9,10,11,12,13,14,15-decahydro-5H-cyclododeca[b]indole |
|---|---|
| PubChem CID | 155805566 |
| Molecular Formula | C34H35N3 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | (6R,15S)-6,15-bis(1H-indol-3-yl)-6,7,8,9,10,11,12,13,14,15-decahydro-5H-cyclododeca[b]indole |
| SMILES | c1ccc2c([C@H]3CCCCCCCC[C@@H](c4c[nH]c5ccccc45)c4c3[nH]c3ccccc43)c[nH]c2c1 |
| InChI | InChI=1S/C34H35N3/c1-2-4-6-16-26(29-22-36-31-19-11-8-14-24(29)31)34-33(27-17-9-12-20-32(27)37-34)25(15-5-3-1)28-21-35-30-18-10-7-13-23(28)30/h7-14,17-22,25-26,35-37H,1-6,15-16H2/t25-,26+/m0/s1 |
| InChIKey | OJSVMGCVRIXMCO-IZZNHLLZSA-N |
| XLogP | 9.53 |
| TPSA | 47.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |