C27H20BrN3 — CID 155816934
(1R,3R)-2-bromo-1,3-bis(1H-indol-3-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 155816934) has the molecular formula C27H20BrN3 and a molecular weight of 466.38 g/mol. Its IUPAC name is (1R,3R)-2-bromo-1,3-bis(1H-indol-3-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole.
| Compound Name | (1R,3R)-2-bromo-1,3-bis(1H-indol-3-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 155816934 |
| Molecular Formula | C27H20BrN3 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | (1R,3R)-2-bromo-1,3-bis(1H-indol-3-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | BrC1[C@H](c2c[nH]c3ccccc23)c2c([nH]c3ccccc23)[C@H]1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H20BrN3/c28-26-23(18-13-29-20-10-4-1-7-15(18)20)24-17-9-3-6-12-22(17)31-27(24)25(26)19-14-30-21-11-5-2-8-16(19)21/h1-14,23,25-26,29-31H/t23-,25+,26?/m1/s1 |
| InChIKey | WGWDIZCURQUFTF-MXYRDWRVSA-N |
| XLogP | 7.17 |
| TPSA | 47.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|