C21H18N2O3 — CID 10269123
2,3-dihydroxy-1-(1H-indol-3-yl)-2,3,4,9-tetrahydro-1H-carbazole-4-carbaldehyde (PubChem CID 10269123) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2,3-dihydroxy-1-(1H-indol-3-yl)-2,3,4,9-tetrahydro-1H-carbazole-4-carbaldehyde.
| Compound Name | 2,3-dihydroxy-1-(1H-indol-3-yl)-2,3,4,9-tetrahydro-1H-carbazole-4-carbaldehyde |
|---|---|
| PubChem CID | 10269123 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2,3-dihydroxy-1-(1H-indol-3-yl)-2,3,4,9-tetrahydro-1H-carbazole-4-carbaldehyde |
| SMILES | O=CC1c2c([nH]c3ccccc23)C(c2c[nH]c3ccccc23)C(O)C1O |
| InChI | InChI=1S/C21H18N2O3/c24-10-14-17-12-6-2-4-8-16(12)23-19(17)18(21(26)20(14)25)13-9-22-15-7-3-1-5-11(13)15/h1-10,14,18,20-23,25-26H |
| InChIKey | NFMNZELFRYJZET-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|