C31H23N3O2 — CID 177425594
(1R,2S,3S)-3-(1H-indol-3-yl)-1-(4-nitrophenyl)-2-phenyl-1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 177425594) has the molecular formula C31H23N3O2 and a molecular weight of 469.54 g/mol. Its IUPAC name is (1R,2S,3S)-3-(1H-indol-3-yl)-1-(4-nitrophenyl)-2-phenyl-1,2,3,4-tetrahydrocyclopenta[b]indole.
| Compound Name | (1R,2S,3S)-3-(1H-indol-3-yl)-1-(4-nitrophenyl)-2-phenyl-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 177425594 |
| Molecular Formula | C31H23N3O2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (1R,2S,3S)-3-(1H-indol-3-yl)-1-(4-nitrophenyl)-2-phenyl-1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2c3c([nH]c4ccccc34)[C@H](c3c[nH]c4ccccc34)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H23N3O2/c35-34(36)21-16-14-20(15-17-21)28-27(19-8-2-1-3-9-19)30(24-18-32-25-12-6-4-10-22(24)25)31-29(28)23-11-5-7-13-26(23)33-31/h1-18,27-28,30,32-33H/t27-,28-,30+/m0/s1 |
| InChIKey | REMMFFLFXIUZGN-TWLDFKIOSA-N |
| XLogP | 7.62 |
| TPSA | 74.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|