C24H20N2O3 — CID 101490931
3-[2-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-chromen-4-yl]-1H-indole (PubChem CID 101490931) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[2-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-chromen-4-yl]-1H-indole.
| Compound Name | 3-[2-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-chromen-4-yl]-1H-indole |
|---|---|
| PubChem CID | 101490931 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 3-[2-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-chromen-4-yl]-1H-indole |
| SMILES | Cc1ccc(C2Oc3ccccc3C(c3c[nH]c4ccccc34)C2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H20N2O3/c1-15-10-12-16(13-11-15)24-23(26(27)28)22(18-7-3-5-9-21(18)29-24)19-14-25-20-8-4-2-6-17(19)20/h2-14,22-25H,1H3 |
| InChIKey | FYMGQESPDDRDGS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|