C15H13NO4 — CID 1229687
(2R,3S,4R)-3-nitro-2-phenyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 1229687) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is (2R,3S,4R)-3-nitro-2-phenyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (2R,3S,4R)-3-nitro-2-phenyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 1229687 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (2R,3S,4R)-3-nitro-2-phenyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O=[N+]([O-])[C@H]1[C@H](O)c2ccccc2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H13NO4/c17-14-11-8-4-5-9-12(11)20-15(13(14)16(18)19)10-6-2-1-3-7-10/h1-9,13-15,17H/t13-,14+,15+/m0/s1 |
| InChIKey | XVWSCHIGUVCLPQ-RRFJBIMHSA-N |
| XLogP | 2.50 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|